About 1-(4-chloro-3,5-dimethylpyrazol-1-yl)butan-1-ol
1-(4-chloro-3,5-dimethylpyrazol-1-yl)butan-1-ol (PubChem CID 70565587) has the molecular formula C9H15ClN2O
and a molecular weight of 202.69 g/mol. Its IUPAC name is 1-(4-chloro-3,5-dimethylpyrazol-1-yl)butan-1-ol.
Molecular Properties
| Compound Name | 1-(4-chloro-3,5-dimethylpyrazol-1-yl)butan-1-ol |
| PubChem CID | 70565587 |
| Molecular Formula | C9H15ClN2O |
| Molecular Weight | 202.69 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 1-(4-chloro-3,5-dimethylpyrazol-1-yl)butan-1-ol |
| SMILES | CCCC(O)n1nc(C)c(Cl)c1C |
| InChI | InChI=1S/C9H15ClN2O/c1-4-5-8(13)12-7(3)9(10)6(2)11-12/h8,13H,4-5H2,1-3H3 |
| InChIKey | NETPIGOGCSZTHA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.69 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-chloro-3,5-dimethylpyrazol-1-yl)butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chloro-3,5-dimethylpyrazol-1-yl)butan-1-ol?
The IUPAC name of 1-(4-chloro-3,5-dimethylpyrazol-1-yl)butan-1-ol (CID 70565587) is 1-(4-chloro-3,5-dimethylpyrazol-1-yl)butan-1-ol.
What is the SMILES notation for 1-(4-chloro-3,5-dimethylpyrazol-1-yl)butan-1-ol?
The canonical SMILES for 1-(4-chloro-3,5-dimethylpyrazol-1-yl)butan-1-ol is CCCC(O)n1nc(C)c(Cl)c1C.
What is the InChIKey of 1-(4-chloro-3,5-dimethylpyrazol-1-yl)butan-1-ol?
The InChIKey is NETPIGOGCSZTHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15ClN2O/c1-4-5-8(13)12-7(3)9(10)6(2)11-12/h8,13H,4-5H2,1-3H3.
What are the key properties of 1-(4-chloro-3,5-dimethylpyrazol-1-yl)butan-1-ol?
1-(4-chloro-3,5-dimethylpyrazol-1-yl)butan-1-ol has a molecular weight of 202.69 g/mol, XLogP of 2.44, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chloro-3,5-dimethylpyrazol-1-yl)butan-1-ol is sourced from PubChem (CID 70565587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).