C29H27N5O9S — CID 70565857
(6S)-7-[[(2S)-2-[[2-(2-nitrophenoxy)acetyl]amino]-2-phenylacetyl]amino]-8-oxo-3-(pyridin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid hydroxide (PubChem CID 70565857) has the molecular formula C29H27N5O9S and a molecular weight of 621.63 g/mol. Its IUPAC name is (6S)-7-[[(2S)-2-[[2-(2-nitrophenoxy)acetyl]amino]-2-phenylacetyl]amino]-8-oxo-3-(pyridin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid hydroxide.
| Compound Name | (6S)-7-[[(2S)-2-[[2-(2-nitrophenoxy)acetyl]amino]-2-phenylacetyl]amino]-8-oxo-3-(pyridin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid hydroxide |
|---|---|
| PubChem CID | 70565857 |
| Molecular Formula | C29H27N5O9S |
| Molecular Weight | 621.63 g/mol |
| Exact Mass | 621.15 |
| IUPAC Name | (6S)-7-[[(2S)-2-[[2-(2-nitrophenoxy)acetyl]amino]-2-phenylacetyl]amino]-8-oxo-3-(pyridin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid hydroxide |
| SMILES | O=C(COc1ccccc1[N+](=O)[O-])N[C@H](C(=O)NC1C(=O)N2C(C(=O)O)=C(C[n+]3ccccc3)CS[C@@H]12)c1ccccc1.[OH-] |
| InChI | InChI=1S/C29H25N5O8S.H2O/c35-22(16-42-21-12-6-5-11-20(21)34(40)41)30-23(18-9-3-1-4-10-18)26(36)31-24-27(37)33-25(29(38)39)19(17-43-28(24)33)15-32-13-7-2-8-14-32;/h1-14,23-24,28H,15-17H2,(H2-,30,31,35,36,38,39);1H2/t23-,24?,28-;/m0./s1 |
| InChIKey | UEXNTKZIPQKKPY-KEYSLPDHSA-N |
| XLogP | 1.38 |
| TPSA | 202.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.63 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|