C16H23Cl3N2O4 — CID 70565977
2-aminoacetic acid;2,2,2-trichloroethyl (2S)-2-(2,4,5-trimethylanilino)propanoate (PubChem CID 70565977) has the molecular formula C16H23Cl3N2O4 and a molecular weight of 413.73 g/mol. Its IUPAC name is 2-aminoacetic acid;2,2,2-trichloroethyl (2S)-2-(2,4,5-trimethylanilino)propanoate.
| Compound Name | 2-aminoacetic acid;2,2,2-trichloroethyl (2S)-2-(2,4,5-trimethylanilino)propanoate |
|---|---|
| PubChem CID | 70565977 |
| Molecular Formula | C16H23Cl3N2O4 |
| Molecular Weight | 413.73 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | 2-aminoacetic acid;2,2,2-trichloroethyl (2S)-2-(2,4,5-trimethylanilino)propanoate |
| SMILES | Cc1cc(C)c(N[C@@H](C)C(=O)OCC(Cl)(Cl)Cl)cc1C.NCC(=O)O |
| InChI | InChI=1S/C14H18Cl3NO2.C2H5NO2/c1-8-5-10(3)12(6-9(8)2)18-11(4)13(19)20-7-14(15,16)17;3-1-2(4)5/h5-6,11,18H,7H2,1-4H3;1,3H2,(H,4,5)/t11-;/m0./s1 |
| InChIKey | FWUARRODUXGTFN-MERQFXBCSA-N |
| XLogP | 3.36 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.73 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|