About 1-[4-(2-hydroxypropyl)-2,5-dimethyl-1-phenylpyrrol-3-yl]propan-2-ol
1-[4-(2-hydroxypropyl)-2,5-dimethyl-1-phenylpyrrol-3-yl]propan-2-ol (PubChem CID 70566523) has the molecular formula C18H25NO2
and a molecular weight of 287.40 g/mol. Its IUPAC name is 1-[4-(2-hydroxypropyl)-2,5-dimethyl-1-phenylpyrrol-3-yl]propan-2-ol.
Molecular Properties
| Compound Name | 1-[4-(2-hydroxypropyl)-2,5-dimethyl-1-phenylpyrrol-3-yl]propan-2-ol |
| PubChem CID | 70566523 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 1-[4-(2-hydroxypropyl)-2,5-dimethyl-1-phenylpyrrol-3-yl]propan-2-ol |
| SMILES | Cc1c(CC(C)O)c(CC(C)O)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C18H25NO2/c1-12(20)10-17-14(3)19(16-8-6-5-7-9-16)15(4)18(17)11-13(2)21/h5-9,12-13,20-21H,10-11H2,1-4H3 |
| InChIKey | LNWVIJVBSVAYTN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[4-(2-hydroxypropyl)-2,5-dimethyl-1-phenylpyrrol-3-yl]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(2-hydroxypropyl)-2,5-dimethyl-1-phenylpyrrol-3-yl]propan-2-ol?
The IUPAC name of 1-[4-(2-hydroxypropyl)-2,5-dimethyl-1-phenylpyrrol-3-yl]propan-2-ol (CID 70566523) is 1-[4-(2-hydroxypropyl)-2,5-dimethyl-1-phenylpyrrol-3-yl]propan-2-ol.
What is the SMILES notation for 1-[4-(2-hydroxypropyl)-2,5-dimethyl-1-phenylpyrrol-3-yl]propan-2-ol?
The canonical SMILES for 1-[4-(2-hydroxypropyl)-2,5-dimethyl-1-phenylpyrrol-3-yl]propan-2-ol is Cc1c(CC(C)O)c(CC(C)O)c(C)n1-c1ccccc1.
What is the InChIKey of 1-[4-(2-hydroxypropyl)-2,5-dimethyl-1-phenylpyrrol-3-yl]propan-2-ol?
The InChIKey is LNWVIJVBSVAYTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25NO2/c1-12(20)10-17-14(3)19(16-8-6-5-7-9-16)15(4)18(17)11-13(2)21/h5-9,12-13,20-21H,10-11H2,1-4H3.
What are the key properties of 1-[4-(2-hydroxypropyl)-2,5-dimethyl-1-phenylpyrrol-3-yl]propan-2-ol?
1-[4-(2-hydroxypropyl)-2,5-dimethyl-1-phenylpyrrol-3-yl]propan-2-ol has a molecular weight of 287.40 g/mol, XLogP of 2.94, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(2-hydroxypropyl)-2,5-dimethyl-1-phenylpyrrol-3-yl]propan-2-ol is sourced from PubChem (CID 70566523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).