About cyclopropylmethanamine;1-(cyclopropylmethyl)-4-oxo-6-phenylpyridine-3-carboxylic acid
cyclopropylmethanamine;1-(cyclopropylmethyl)-4-oxo-6-phenylpyridine-3-carboxylic acid (PubChem CID 70566584) has the molecular formula C20H24N2O3
and a molecular weight of 340.42 g/mol. Its IUPAC name is cyclopropylmethanamine;1-(cyclopropylmethyl)-4-oxo-6-phenylpyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | cyclopropylmethanamine;1-(cyclopropylmethyl)-4-oxo-6-phenylpyridine-3-carboxylic acid |
| PubChem CID | 70566584 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | cyclopropylmethanamine;1-(cyclopropylmethyl)-4-oxo-6-phenylpyridine-3-carboxylic acid |
| SMILES | NCC1CC1.O=C(O)c1cn(CC2CC2)c(-c2ccccc2)cc1=O |
| InChI | InChI=1S/C16H15NO3.C4H9N/c18-15-8-14(12-4-2-1-3-5-12)17(9-11-6-7-11)10-13(15)16(19)20;5-3-4-1-2-4/h1-5,8,10-11H,6-7,9H2,(H,19,20);4H,1-3,5H2 |
| InChIKey | UXMSSLOVDZCQBQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cyclopropylmethanamine;1-(cyclopropylmethyl)-4-oxo-6-phenylpyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropylmethanamine;1-(cyclopropylmethyl)-4-oxo-6-phenylpyridine-3-carboxylic acid?
The IUPAC name of cyclopropylmethanamine;1-(cyclopropylmethyl)-4-oxo-6-phenylpyridine-3-carboxylic acid (CID 70566584) is cyclopropylmethanamine;1-(cyclopropylmethyl)-4-oxo-6-phenylpyridine-3-carboxylic acid.
What is the SMILES notation for cyclopropylmethanamine;1-(cyclopropylmethyl)-4-oxo-6-phenylpyridine-3-carboxylic acid?
The canonical SMILES for cyclopropylmethanamine;1-(cyclopropylmethyl)-4-oxo-6-phenylpyridine-3-carboxylic acid is NCC1CC1.O=C(O)c1cn(CC2CC2)c(-c2ccccc2)cc1=O.
What is the InChIKey of cyclopropylmethanamine;1-(cyclopropylmethyl)-4-oxo-6-phenylpyridine-3-carboxylic acid?
The InChIKey is UXMSSLOVDZCQBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO3.C4H9N/c18-15-8-14(12-4-2-1-3-5-12)17(9-11-6-7-11)10-13(15)16(19)20;5-3-4-1-2-4/h1-5,8,10-11H,6-7,9H2,(H,19,20);4H,1-3,5H2.
What are the key properties of cyclopropylmethanamine;1-(cyclopropylmethyl)-4-oxo-6-phenylpyridine-3-carboxylic acid?
cyclopropylmethanamine;1-(cyclopropylmethyl)-4-oxo-6-phenylpyridine-3-carboxylic acid has a molecular weight of 340.42 g/mol, XLogP of 2.98, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropylmethanamine;1-(cyclopropylmethyl)-4-oxo-6-phenylpyridine-3-carboxylic acid is sourced from PubChem (CID 70566584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).