C17H16Cl3NO3 — CID 70566809
2-(2-methoxyphenyl)-2-(2,4,5-trichloro-N-ethylanilino)acetic acid (PubChem CID 70566809) has the molecular formula C17H16Cl3NO3 and a molecular weight of 388.68 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-2-(2,4,5-trichloro-N-ethylanilino)acetic acid.
| Compound Name | 2-(2-methoxyphenyl)-2-(2,4,5-trichloro-N-ethylanilino)acetic acid |
|---|---|
| PubChem CID | 70566809 |
| Molecular Formula | C17H16Cl3NO3 |
| Molecular Weight | 388.68 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | 2-(2-methoxyphenyl)-2-(2,4,5-trichloro-N-ethylanilino)acetic acid |
| SMILES | CCN(c1cc(Cl)c(Cl)cc1Cl)C(C(=O)O)c1ccccc1OC |
| InChI | InChI=1S/C17H16Cl3NO3/c1-3-21(14-9-12(19)11(18)8-13(14)20)16(17(22)23)10-6-4-5-7-15(10)24-2/h4-9,16H,3H2,1-2H3,(H,22,23) |
| InChIKey | JGJIRDAJILNURF-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.68 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|