About bromo N-(2-bicyclo[2.2.1]heptanyl)-N-methylcarbamate;hydrobromide
bromo N-(2-bicyclo[2.2.1]heptanyl)-N-methylcarbamate;hydrobromide (PubChem CID 70567061) has the molecular formula C9H15Br2NO2
and a molecular weight of 329.03 g/mol. Its IUPAC name is bromo N-(2-bicyclo[2.2.1]heptanyl)-N-methylcarbamate;hydrobromide.
Molecular Properties
| Compound Name | bromo N-(2-bicyclo[2.2.1]heptanyl)-N-methylcarbamate;hydrobromide |
| PubChem CID | 70567061 |
| Molecular Formula | C9H15Br2NO2 |
| Molecular Weight | 329.03 g/mol |
| Exact Mass | 326.95 |
| IUPAC Name | bromo N-(2-bicyclo[2.2.1]heptanyl)-N-methylcarbamate;hydrobromide |
| SMILES | Br.CN(C(=O)OBr)C1CC2CCC1C2 |
| InChI | InChI=1S/C9H14BrNO2.BrH/c1-11(9(12)13-10)8-5-6-2-3-7(8)4-6;/h6-8H,2-5H2,1H3;1H |
| InChIKey | PJDYWGLHVRSTCA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.03 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bromo N-(2-bicyclo[2.2.1]heptanyl)-N-methylcarbamate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromo N-(2-bicyclo[2.2.1]heptanyl)-N-methylcarbamate;hydrobromide?
The IUPAC name of bromo N-(2-bicyclo[2.2.1]heptanyl)-N-methylcarbamate;hydrobromide (CID 70567061) is bromo N-(2-bicyclo[2.2.1]heptanyl)-N-methylcarbamate;hydrobromide.
What is the SMILES notation for bromo N-(2-bicyclo[2.2.1]heptanyl)-N-methylcarbamate;hydrobromide?
The canonical SMILES for bromo N-(2-bicyclo[2.2.1]heptanyl)-N-methylcarbamate;hydrobromide is Br.CN(C(=O)OBr)C1CC2CCC1C2.
What is the InChIKey of bromo N-(2-bicyclo[2.2.1]heptanyl)-N-methylcarbamate;hydrobromide?
The InChIKey is PJDYWGLHVRSTCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14BrNO2.BrH/c1-11(9(12)13-10)8-5-6-2-3-7(8)4-6;/h6-8H,2-5H2,1H3;1H.
What are the key properties of bromo N-(2-bicyclo[2.2.1]heptanyl)-N-methylcarbamate;hydrobromide?
bromo N-(2-bicyclo[2.2.1]heptanyl)-N-methylcarbamate;hydrobromide has a molecular weight of 329.03 g/mol, XLogP of 3.13, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bromo N-(2-bicyclo[2.2.1]heptanyl)-N-methylcarbamate;hydrobromide is sourced from PubChem (CID 70567061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).