About 4,6-dimethoxy-3H-1,3-benzothiazol-2-one
4,6-dimethoxy-3H-1,3-benzothiazol-2-one (PubChem CID 70567156) has the molecular formula C9H9NO3S
and a molecular weight of 211.24 g/mol. Its IUPAC name is 4,6-dimethoxy-3H-1,3-benzothiazol-2-one.
Molecular Properties
| Compound Name | 4,6-dimethoxy-3H-1,3-benzothiazol-2-one |
| PubChem CID | 70567156 |
| Molecular Formula | C9H9NO3S |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.03 |
| IUPAC Name | 4,6-dimethoxy-3H-1,3-benzothiazol-2-one |
| SMILES | COc1cc(OC)c2[nH]c(=O)sc2c1 |
| InChI | InChI=1S/C9H9NO3S/c1-12-5-3-6(13-2)8-7(4-5)14-9(11)10-8/h3-4H,1-2H3,(H,10,11) |
| InChIKey | OJYPFAOPZKRDTG-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,6-dimethoxy-3H-1,3-benzothiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethoxy-3H-1,3-benzothiazol-2-one?
The IUPAC name of 4,6-dimethoxy-3H-1,3-benzothiazol-2-one (CID 70567156) is 4,6-dimethoxy-3H-1,3-benzothiazol-2-one.
What is the SMILES notation for 4,6-dimethoxy-3H-1,3-benzothiazol-2-one?
The canonical SMILES for 4,6-dimethoxy-3H-1,3-benzothiazol-2-one is COc1cc(OC)c2[nH]c(=O)sc2c1.
What is the InChIKey of 4,6-dimethoxy-3H-1,3-benzothiazol-2-one?
The InChIKey is OJYPFAOPZKRDTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO3S/c1-12-5-3-6(13-2)8-7(4-5)14-9(11)10-8/h3-4H,1-2H3,(H,10,11).
What are the key properties of 4,6-dimethoxy-3H-1,3-benzothiazol-2-one?
4,6-dimethoxy-3H-1,3-benzothiazol-2-one has a molecular weight of 211.24 g/mol, XLogP of 1.61, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethoxy-3H-1,3-benzothiazol-2-one is sourced from PubChem (CID 70567156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).