C20H32O5 — CID 70567193
(1S,2R,3aS,6aS)-6a-hydroxy-2-(1-hydroxyoct-1-enyl)-1-[(E)-prop-1-enoxy]-1,3,3a,4,5,6-hexahydropentalene-2-carboxylic acid (PubChem CID 70567193) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is (1S,2R,3aS,6aS)-6a-hydroxy-2-(1-hydroxyoct-1-enyl)-1-[(E)-prop-1-enoxy]-1,3,3a,4,5,6-hexahydropentalene-2-carboxylic acid.
| Compound Name | (1S,2R,3aS,6aS)-6a-hydroxy-2-(1-hydroxyoct-1-enyl)-1-[(E)-prop-1-enoxy]-1,3,3a,4,5,6-hexahydropentalene-2-carboxylic acid |
|---|---|
| PubChem CID | 70567193 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | (1S,2R,3aS,6aS)-6a-hydroxy-2-(1-hydroxyoct-1-enyl)-1-[(E)-prop-1-enoxy]-1,3,3a,4,5,6-hexahydropentalene-2-carboxylic acid |
| SMILES | C/C=C/O[C@H]1[C@@](C(=O)O)(C(O)=CCCCCCC)C[C@@H]2CCC[C@]21O |
| InChI | InChI=1S/C20H32O5/c1-3-5-6-7-8-11-16(21)19(18(22)23)14-15-10-9-12-20(15,24)17(19)25-13-4-2/h4,11,13,15,17,21,24H,3,5-10,12,14H2,1-2H3,(H,22,23)/b13-4+,16-11?/t15-,17-,19-,20-/m0/s1 |
| InChIKey | NSXMGDFJAXRFJG-XRCRRISWSA-N |
| XLogP | 4.32 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|