About 1-[(3,4-dichlorophenyl)methyl]-3,6-dihydro-2H-pyridine;hydrochloride
1-[(3,4-dichlorophenyl)methyl]-3,6-dihydro-2H-pyridine;hydrochloride (PubChem CID 70567231) has the molecular formula C12H14Cl3N
and a molecular weight of 278.61 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-3,6-dihydro-2H-pyridine;hydrochloride.
Molecular Properties
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-3,6-dihydro-2H-pyridine;hydrochloride |
| PubChem CID | 70567231 |
| Molecular Formula | C12H14Cl3N |
| Molecular Weight | 278.61 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-3,6-dihydro-2H-pyridine;hydrochloride |
| SMILES | Cl.Clc1ccc(CN2CC=CCC2)cc1Cl |
| InChI | InChI=1S/C12H13Cl2N.ClH/c13-11-5-4-10(8-12(11)14)9-15-6-2-1-3-7-15;/h1-2,4-5,8H,3,6-7,9H2;1H |
| InChIKey | KPGUMQXAONXKDF-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.61 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3,4-dichlorophenyl)methyl]-3,6-dihydro-2H-pyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,4-dichlorophenyl)methyl]-3,6-dihydro-2H-pyridine;hydrochloride?
The IUPAC name of 1-[(3,4-dichlorophenyl)methyl]-3,6-dihydro-2H-pyridine;hydrochloride (CID 70567231) is 1-[(3,4-dichlorophenyl)methyl]-3,6-dihydro-2H-pyridine;hydrochloride.
What is the SMILES notation for 1-[(3,4-dichlorophenyl)methyl]-3,6-dihydro-2H-pyridine;hydrochloride?
The canonical SMILES for 1-[(3,4-dichlorophenyl)methyl]-3,6-dihydro-2H-pyridine;hydrochloride is Cl.Clc1ccc(CN2CC=CCC2)cc1Cl.
What is the InChIKey of 1-[(3,4-dichlorophenyl)methyl]-3,6-dihydro-2H-pyridine;hydrochloride?
The InChIKey is KPGUMQXAONXKDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13Cl2N.ClH/c13-11-5-4-10(8-12(11)14)9-15-6-2-1-3-7-15;/h1-2,4-5,8H,3,6-7,9H2;1H.
What are the key properties of 1-[(3,4-dichlorophenyl)methyl]-3,6-dihydro-2H-pyridine;hydrochloride?
1-[(3,4-dichlorophenyl)methyl]-3,6-dihydro-2H-pyridine;hydrochloride has a molecular weight of 278.61 g/mol, XLogP of 4.18, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,4-dichlorophenyl)methyl]-3,6-dihydro-2H-pyridine;hydrochloride is sourced from PubChem (CID 70567231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).