About 4-oxo-6-phenyl-1-propan-2-ylpyridine-3-carboxylic acid;propan-2-amine
4-oxo-6-phenyl-1-propan-2-ylpyridine-3-carboxylic acid;propan-2-amine (PubChem CID 70567354) has the molecular formula C18H24N2O3
and a molecular weight of 316.40 g/mol. Its IUPAC name is 4-oxo-6-phenyl-1-propan-2-ylpyridine-3-carboxylic acid;propan-2-amine.
Molecular Properties
| Compound Name | 4-oxo-6-phenyl-1-propan-2-ylpyridine-3-carboxylic acid;propan-2-amine |
| PubChem CID | 70567354 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 4-oxo-6-phenyl-1-propan-2-ylpyridine-3-carboxylic acid;propan-2-amine |
| SMILES | CC(C)N.CC(C)n1cc(C(=O)O)c(=O)cc1-c1ccccc1 |
| InChI | InChI=1S/C15H15NO3.C3H9N/c1-10(2)16-9-12(15(18)19)14(17)8-13(16)11-6-4-3-5-7-11;1-3(2)4/h3-10H,1-2H3,(H,18,19);3H,4H2,1-2H3 |
| InChIKey | XFSFBZGXFBAIHE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-oxo-6-phenyl-1-propan-2-ylpyridine-3-carboxylic acid;propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxo-6-phenyl-1-propan-2-ylpyridine-3-carboxylic acid;propan-2-amine?
The IUPAC name of 4-oxo-6-phenyl-1-propan-2-ylpyridine-3-carboxylic acid;propan-2-amine (CID 70567354) is 4-oxo-6-phenyl-1-propan-2-ylpyridine-3-carboxylic acid;propan-2-amine.
What is the SMILES notation for 4-oxo-6-phenyl-1-propan-2-ylpyridine-3-carboxylic acid;propan-2-amine?
The canonical SMILES for 4-oxo-6-phenyl-1-propan-2-ylpyridine-3-carboxylic acid;propan-2-amine is CC(C)N.CC(C)n1cc(C(=O)O)c(=O)cc1-c1ccccc1.
What is the InChIKey of 4-oxo-6-phenyl-1-propan-2-ylpyridine-3-carboxylic acid;propan-2-amine?
The InChIKey is XFSFBZGXFBAIHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO3.C3H9N/c1-10(2)16-9-12(15(18)19)14(17)8-13(16)11-6-4-3-5-7-11;1-3(2)4/h3-10H,1-2H3,(H,18,19);3H,4H2,1-2H3.
What are the key properties of 4-oxo-6-phenyl-1-propan-2-ylpyridine-3-carboxylic acid;propan-2-amine?
4-oxo-6-phenyl-1-propan-2-ylpyridine-3-carboxylic acid;propan-2-amine has a molecular weight of 316.40 g/mol, XLogP of 3.15, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-6-phenyl-1-propan-2-ylpyridine-3-carboxylic acid;propan-2-amine is sourced from PubChem (CID 70567354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).