About 1-(1,2,2,2-tetrachloroethyl)pyrazole;hydrochloride
1-(1,2,2,2-tetrachloroethyl)pyrazole;hydrochloride (PubChem CID 70567368) has the molecular formula C5H5Cl5N2
and a molecular weight of 270.37 g/mol. Its IUPAC name is 1-(1,2,2,2-tetrachloroethyl)pyrazole;hydrochloride.
Molecular Properties
| Compound Name | 1-(1,2,2,2-tetrachloroethyl)pyrazole;hydrochloride |
| PubChem CID | 70567368 |
| Molecular Formula | C5H5Cl5N2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 267.89 |
| IUPAC Name | 1-(1,2,2,2-tetrachloroethyl)pyrazole;hydrochloride |
| SMILES | Cl.ClC(n1cccn1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C5H4Cl4N2.ClH/c6-4(5(7,8)9)11-3-1-2-10-11;/h1-4H;1H |
| InChIKey | OUVNNGTVQRZANB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,2,2,2-tetrachloroethyl)pyrazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,2,2,2-tetrachloroethyl)pyrazole;hydrochloride?
The IUPAC name of 1-(1,2,2,2-tetrachloroethyl)pyrazole;hydrochloride (CID 70567368) is 1-(1,2,2,2-tetrachloroethyl)pyrazole;hydrochloride.
What is the SMILES notation for 1-(1,2,2,2-tetrachloroethyl)pyrazole;hydrochloride?
The canonical SMILES for 1-(1,2,2,2-tetrachloroethyl)pyrazole;hydrochloride is Cl.ClC(n1cccn1)C(Cl)(Cl)Cl.
What is the InChIKey of 1-(1,2,2,2-tetrachloroethyl)pyrazole;hydrochloride?
The InChIKey is OUVNNGTVQRZANB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4Cl4N2.ClH/c6-4(5(7,8)9)11-3-1-2-10-11;/h1-4H;1H.
What are the key properties of 1-(1,2,2,2-tetrachloroethyl)pyrazole;hydrochloride?
1-(1,2,2,2-tetrachloroethyl)pyrazole;hydrochloride has a molecular weight of 270.37 g/mol, XLogP of 3.41, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,2,2,2-tetrachloroethyl)pyrazole;hydrochloride is sourced from PubChem (CID 70567368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).