About 3-hydroxy-1H-pyridin-2-one;naphthalene
3-hydroxy-1H-pyridin-2-one;naphthalene (PubChem CID 70567411) has the molecular formula C15H13NO2
and a molecular weight of 239.27 g/mol. Its IUPAC name is 3-hydroxy-1H-pyridin-2-one;naphthalene.
Molecular Properties
| Compound Name | 3-hydroxy-1H-pyridin-2-one;naphthalene |
| PubChem CID | 70567411 |
| Molecular Formula | C15H13NO2 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 3-hydroxy-1H-pyridin-2-one;naphthalene |
| SMILES | O=c1[nH]cccc1O.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C5H5NO2/c1-2-6-10-8-4-3-7-9(10)5-1;7-4-2-1-3-6-5(4)8/h1-8H;1-3,7H,(H,6,8) |
| InChIKey | ZKQXPKFGHYRPOY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-hydroxy-1H-pyridin-2-one;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-1H-pyridin-2-one;naphthalene?
The IUPAC name of 3-hydroxy-1H-pyridin-2-one;naphthalene (CID 70567411) is 3-hydroxy-1H-pyridin-2-one;naphthalene.
What is the SMILES notation for 3-hydroxy-1H-pyridin-2-one;naphthalene?
The canonical SMILES for 3-hydroxy-1H-pyridin-2-one;naphthalene is O=c1[nH]cccc1O.c1ccc2ccccc2c1.
What is the InChIKey of 3-hydroxy-1H-pyridin-2-one;naphthalene?
The InChIKey is ZKQXPKFGHYRPOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.C5H5NO2/c1-2-6-10-8-4-3-7-9(10)5-1;7-4-2-1-3-6-5(4)8/h1-8H;1-3,7H,(H,6,8).
What are the key properties of 3-hydroxy-1H-pyridin-2-one;naphthalene?
3-hydroxy-1H-pyridin-2-one;naphthalene has a molecular weight of 239.27 g/mol, XLogP of 2.92, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-1H-pyridin-2-one;naphthalene is sourced from PubChem (CID 70567411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).