About cyclohexanamine;1-cyclohexyl-4-oxo-6-phenylpyridine-3-carboxylic acid
cyclohexanamine;1-cyclohexyl-4-oxo-6-phenylpyridine-3-carboxylic acid (PubChem CID 70567624) has the molecular formula C24H32N2O3
and a molecular weight of 396.53 g/mol. Its IUPAC name is cyclohexanamine;1-cyclohexyl-4-oxo-6-phenylpyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | cyclohexanamine;1-cyclohexyl-4-oxo-6-phenylpyridine-3-carboxylic acid |
| PubChem CID | 70567624 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | cyclohexanamine;1-cyclohexyl-4-oxo-6-phenylpyridine-3-carboxylic acid |
| SMILES | NC1CCCCC1.O=C(O)c1cn(C2CCCCC2)c(-c2ccccc2)cc1=O |
| InChI | InChI=1S/C18H19NO3.C6H13N/c20-17-11-16(13-7-3-1-4-8-13)19(12-15(17)18(21)22)14-9-5-2-6-10-14;7-6-4-2-1-3-5-6/h1,3-4,7-8,11-12,14H,2,5-6,9-10H2,(H,21,22);6H,1-5,7H2 |
| InChIKey | LWYKYQCVSVOLMC-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cyclohexanamine;1-cyclohexyl-4-oxo-6-phenylpyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexanamine;1-cyclohexyl-4-oxo-6-phenylpyridine-3-carboxylic acid?
The IUPAC name of cyclohexanamine;1-cyclohexyl-4-oxo-6-phenylpyridine-3-carboxylic acid (CID 70567624) is cyclohexanamine;1-cyclohexyl-4-oxo-6-phenylpyridine-3-carboxylic acid.
What is the SMILES notation for cyclohexanamine;1-cyclohexyl-4-oxo-6-phenylpyridine-3-carboxylic acid?
The canonical SMILES for cyclohexanamine;1-cyclohexyl-4-oxo-6-phenylpyridine-3-carboxylic acid is NC1CCCCC1.O=C(O)c1cn(C2CCCCC2)c(-c2ccccc2)cc1=O.
What is the InChIKey of cyclohexanamine;1-cyclohexyl-4-oxo-6-phenylpyridine-3-carboxylic acid?
The InChIKey is LWYKYQCVSVOLMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO3.C6H13N/c20-17-11-16(13-7-3-1-4-8-13)19(12-15(17)18(21)22)14-9-5-2-6-10-14;7-6-4-2-1-3-5-6/h1,3-4,7-8,11-12,14H,2,5-6,9-10H2,(H,21,22);6H,1-5,7H2.
What are the key properties of cyclohexanamine;1-cyclohexyl-4-oxo-6-phenylpyridine-3-carboxylic acid?
cyclohexanamine;1-cyclohexyl-4-oxo-6-phenylpyridine-3-carboxylic acid has a molecular weight of 396.53 g/mol, XLogP of 5.00, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexanamine;1-cyclohexyl-4-oxo-6-phenylpyridine-3-carboxylic acid is sourced from PubChem (CID 70567624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).