About 9H-1-benzazepine-3,8-dione
9H-1-benzazepine-3,8-dione (PubChem CID 70568792) has the molecular formula C10H7NO2
and a molecular weight of 173.17 g/mol. Its IUPAC name is 9H-1-benzazepine-3,8-dione.
Molecular Properties
| Compound Name | 9H-1-benzazepine-3,8-dione |
| PubChem CID | 70568792 |
| Molecular Formula | C10H7NO2 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.05 |
| IUPAC Name | 9H-1-benzazepine-3,8-dione |
| SMILES | O=C1C=Cc2ccc(=O)cnc2C1 |
| InChI | InChI=1S/C10H7NO2/c12-8-3-1-7-2-4-9(13)6-11-10(7)5-8/h1-4,6H,5H2 |
| InChIKey | KIKQRLMAYUGUHV-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9H-1-benzazepine-3,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-1-benzazepine-3,8-dione?
The IUPAC name of 9H-1-benzazepine-3,8-dione (CID 70568792) is 9H-1-benzazepine-3,8-dione.
What is the SMILES notation for 9H-1-benzazepine-3,8-dione?
The canonical SMILES for 9H-1-benzazepine-3,8-dione is O=C1C=Cc2ccc(=O)cnc2C1.
What is the InChIKey of 9H-1-benzazepine-3,8-dione?
The InChIKey is KIKQRLMAYUGUHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO2/c12-8-3-1-7-2-4-9(13)6-11-10(7)5-8/h1-4,6H,5H2.
What are the key properties of 9H-1-benzazepine-3,8-dione?
9H-1-benzazepine-3,8-dione has a molecular weight of 173.17 g/mol, XLogP of 0.58, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-1-benzazepine-3,8-dione is sourced from PubChem (CID 70568792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).