C13H19N — CID 70569226
9-methyl-1,2,3,4,4a,4b,5,9a-octahydrocarbazole (PubChem CID 70569226) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is 9-methyl-1,2,3,4,4a,4b,5,9a-octahydrocarbazole.
| Compound Name | 9-methyl-1,2,3,4,4a,4b,5,9a-octahydrocarbazole |
|---|---|
| PubChem CID | 70569226 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 9-methyl-1,2,3,4,4a,4b,5,9a-octahydrocarbazole |
| SMILES | CN1C2=CC=CCC2C2CCCCC21 |
| InChI | InChI=1S/C13H19N/c1-14-12-8-4-2-6-10(12)11-7-3-5-9-13(11)14/h2,4,8,10-11,13H,3,5-7,9H2,1H3 |
| InChIKey | XCEGFOBYMYFBNU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |