C20H24N2O4 — CID 70569241
but-2-enedioic acid;3'-phenylspiro[3,4-dihydropyrrole-5,2'-bicyclo[2.2.1]heptane]-2-amine (PubChem CID 70569241) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is but-2-enedioic acid;3'-phenylspiro[3,4-dihydropyrrole-5,2'-bicyclo[2.2.1]heptane]-2-amine.
| Compound Name | but-2-enedioic acid;3'-phenylspiro[3,4-dihydropyrrole-5,2'-bicyclo[2.2.1]heptane]-2-amine |
|---|---|
| PubChem CID | 70569241 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | but-2-enedioic acid;3'-phenylspiro[3,4-dihydropyrrole-5,2'-bicyclo[2.2.1]heptane]-2-amine |
| SMILES | NC1=NC2(CC1)C1CCC(C1)C2c1ccccc1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C16H20N2.C4H4O4/c17-14-8-9-16(18-14)13-7-6-12(10-13)15(16)11-4-2-1-3-5-11;5-3(6)1-2-4(7)8/h1-5,12-13,15H,6-10H2,(H2,17,18);1-2H,(H,5,6)(H,7,8) |
| InChIKey | FSBRSHSCLLLXHO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 112.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|