C13H16FN3OS — CID 70569922
(4aS,5R,7aS)-7a-(5-amino-2-fluorophenyl)-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-e][1,3]thiazin-2-amine (PubChem CID 70569922) has the molecular formula C13H16FN3OS and a molecular weight of 281.36 g/mol. Its IUPAC name is (4aS,5R,7aS)-7a-(5-amino-2-fluorophenyl)-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-e][1,3]thiazin-2-amine.
| Compound Name | (4aS,5R,7aS)-7a-(5-amino-2-fluorophenyl)-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-e][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 70569922 |
| Molecular Formula | C13H16FN3OS |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | (4aS,5R,7aS)-7a-(5-amino-2-fluorophenyl)-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-e][1,3]thiazin-2-amine |
| SMILES | C[C@H]1OC[C@]2(c3cc(N)ccc3F)SC(N)=NC[C@@H]12 |
| InChI | InChI=1S/C13H16FN3OS/c1-7-10-5-17-12(16)19-13(10,6-18-7)9-4-8(15)2-3-11(9)14/h2-4,7,10H,5-6,15H2,1H3,(H2,16,17)/t7-,10+,13-/m1/s1 |
| InChIKey | XEYSUCJAIWATDR-LIEFSGRHSA-N |
| XLogP | 1.70 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|