C15H18ClN3OS — CID 70570349
2-chloro-3,3-dimethyl-N-phenyl-N-(1,3,4-thiadiazol-2-ylmethyl)butanamide (PubChem CID 70570349) has the molecular formula C15H18ClN3OS and a molecular weight of 323.85 g/mol. Its IUPAC name is 2-chloro-3,3-dimethyl-N-phenyl-N-(1,3,4-thiadiazol-2-ylmethyl)butanamide.
| Compound Name | 2-chloro-3,3-dimethyl-N-phenyl-N-(1,3,4-thiadiazol-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 70570349 |
| Molecular Formula | C15H18ClN3OS |
| Molecular Weight | 323.85 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 2-chloro-3,3-dimethyl-N-phenyl-N-(1,3,4-thiadiazol-2-ylmethyl)butanamide |
| SMILES | CC(C)(C)C(Cl)C(=O)N(Cc1nncs1)c1ccccc1 |
| InChI | InChI=1S/C15H18ClN3OS/c1-15(2,3)13(16)14(20)19(9-12-18-17-10-21-12)11-7-5-4-6-8-11/h4-8,10,13H,9H2,1-3H3 |
| InChIKey | AWTBWNUPZOWRKJ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.85 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|