C18H17N — CID 70571169
16-methyl-4-azatetracyclo[12.4.0.02,6.08,13]octadeca-1(18),2,5,8,10,12,14-heptaene (PubChem CID 70571169) has the molecular formula C18H17N and a molecular weight of 247.34 g/mol. Its IUPAC name is 16-methyl-4-azatetracyclo[12.4.0.02,6.08,13]octadeca-1(18),2,5,8,10,12,14-heptaene.
| Compound Name | 16-methyl-4-azatetracyclo[12.4.0.02,6.08,13]octadeca-1(18),2,5,8,10,12,14-heptaene |
|---|---|
| PubChem CID | 70571169 |
| Molecular Formula | C18H17N |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 16-methyl-4-azatetracyclo[12.4.0.02,6.08,13]octadeca-1(18),2,5,8,10,12,14-heptaene |
| SMILES | CC1C=C2C(=CC1)c1c[nH]cc1Cc1ccccc12 |
| InChI | InChI=1S/C18H17N/c1-12-6-7-16-17(8-12)15-5-3-2-4-13(15)9-14-10-19-11-18(14)16/h2-5,7-8,10-12,19H,6,9H2,1H3 |
| InChIKey | NUBKBIWOSLTRNU-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |