C19H24F3NO3S2 — CID 70571177
(2S)-1-[4,4,4-trifluoro-3-(1-phenyldithian-1-yl)butanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 70571177) has the molecular formula C19H24F3NO3S2 and a molecular weight of 435.53 g/mol. Its IUPAC name is (2S)-1-[4,4,4-trifluoro-3-(1-phenyldithian-1-yl)butanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[4,4,4-trifluoro-3-(1-phenyldithian-1-yl)butanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 70571177 |
| Molecular Formula | C19H24F3NO3S2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | (2S)-1-[4,4,4-trifluoro-3-(1-phenyldithian-1-yl)butanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN1C(=O)CC(C(F)(F)F)S1(c2ccccc2)CCCCS1 |
| InChI | InChI=1S/C19H24F3NO3S2/c20-19(21,22)16(13-17(24)23-10-6-9-15(23)18(25)26)28(12-5-4-11-27-28)14-7-2-1-3-8-14/h1-3,7-8,15-16H,4-6,9-13H2,(H,25,26)/t15-,16?/m0/s1 |
| InChIKey | GNZKIDYXTKMTGN-VYRBHSGPSA-N |
| XLogP | 4.69 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|