About 1-methylbenzimidazole-5,6-diol;hydrobromide
1-methylbenzimidazole-5,6-diol;hydrobromide (PubChem CID 70571502) has the molecular formula C8H9BrN2O2
and a molecular weight of 245.08 g/mol. Its IUPAC name is 1-methylbenzimidazole-5,6-diol;hydrobromide.
Molecular Properties
| Compound Name | 1-methylbenzimidazole-5,6-diol;hydrobromide |
| PubChem CID | 70571502 |
| Molecular Formula | C8H9BrN2O2 |
| Molecular Weight | 245.08 g/mol |
| Exact Mass | 243.98 |
| IUPAC Name | 1-methylbenzimidazole-5,6-diol;hydrobromide |
| SMILES | Br.Cn1cnc2cc(O)c(O)cc21 |
| InChI | InChI=1S/C8H8N2O2.BrH/c1-10-4-9-5-2-7(11)8(12)3-6(5)10;/h2-4,11-12H,1H3;1H |
| InChIKey | HGCLJINUQMGCBM-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.08 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 1-methylbenzimidazole-5,6-diol;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylbenzimidazole-5,6-diol;hydrobromide?
The IUPAC name of 1-methylbenzimidazole-5,6-diol;hydrobromide (CID 70571502) is 1-methylbenzimidazole-5,6-diol;hydrobromide.
What is the SMILES notation for 1-methylbenzimidazole-5,6-diol;hydrobromide?
The canonical SMILES for 1-methylbenzimidazole-5,6-diol;hydrobromide is Br.Cn1cnc2cc(O)c(O)cc21.
What is the InChIKey of 1-methylbenzimidazole-5,6-diol;hydrobromide?
The InChIKey is HGCLJINUQMGCBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O2.BrH/c1-10-4-9-5-2-7(11)8(12)3-6(5)10;/h2-4,11-12H,1H3;1H.
What are the key properties of 1-methylbenzimidazole-5,6-diol;hydrobromide?
1-methylbenzimidazole-5,6-diol;hydrobromide has a molecular weight of 245.08 g/mol, XLogP of 1.56, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylbenzimidazole-5,6-diol;hydrobromide is sourced from PubChem (CID 70571502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).