About 5-ethyl-2-methyl-2,3-dihydro-1H-indole
5-ethyl-2-methyl-2,3-dihydro-1H-indole (PubChem CID 70571795) has the molecular formula C11H15N
and a molecular weight of 161.25 g/mol. Its IUPAC name is 5-ethyl-2-methyl-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 5-ethyl-2-methyl-2,3-dihydro-1H-indole |
| PubChem CID | 70571795 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 5-ethyl-2-methyl-2,3-dihydro-1H-indole |
| SMILES | CCc1ccc2c(c1)CC(C)N2 |
| InChI | InChI=1S/C11H15N/c1-3-9-4-5-11-10(7-9)6-8(2)12-11/h4-5,7-8,12H,3,6H2,1-2H3 |
| InChIKey | KZFPDVZRMYOTFD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-ethyl-2-methyl-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2-methyl-2,3-dihydro-1H-indole?
The IUPAC name of 5-ethyl-2-methyl-2,3-dihydro-1H-indole (CID 70571795) is 5-ethyl-2-methyl-2,3-dihydro-1H-indole.
What is the SMILES notation for 5-ethyl-2-methyl-2,3-dihydro-1H-indole?
The canonical SMILES for 5-ethyl-2-methyl-2,3-dihydro-1H-indole is CCc1ccc2c(c1)CC(C)N2.
What is the InChIKey of 5-ethyl-2-methyl-2,3-dihydro-1H-indole?
The InChIKey is KZFPDVZRMYOTFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N/c1-3-9-4-5-11-10(7-9)6-8(2)12-11/h4-5,7-8,12H,3,6H2,1-2H3.
What are the key properties of 5-ethyl-2-methyl-2,3-dihydro-1H-indole?
5-ethyl-2-methyl-2,3-dihydro-1H-indole has a molecular weight of 161.25 g/mol, XLogP of 2.61, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2-methyl-2,3-dihydro-1H-indole is sourced from PubChem (CID 70571795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).