About but-3-en-2-yloxy(triethyl)silane;cyclopent-3-en-1-one
but-3-en-2-yloxy(triethyl)silane;cyclopent-3-en-1-one (PubChem CID 70572166) has the molecular formula C15H28O2Si
and a molecular weight of 268.47 g/mol. Its IUPAC name is but-3-en-2-yloxy(triethyl)silane;cyclopent-3-en-1-one.
Molecular Properties
| Compound Name | but-3-en-2-yloxy(triethyl)silane;cyclopent-3-en-1-one |
| PubChem CID | 70572166 |
| Molecular Formula | C15H28O2Si |
| Molecular Weight | 268.47 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | but-3-en-2-yloxy(triethyl)silane;cyclopent-3-en-1-one |
| SMILES | C=CC(C)O[Si](CC)(CC)CC.O=C1CC=CC1 |
| InChI | InChI=1S/C10H22OSi.C5H6O/c1-6-10(5)11-12(7-2,8-3)9-4;6-5-3-1-2-4-5/h6,10H,1,7-9H2,2-5H3;1-2H,3-4H2 |
| InChIKey | CHEYQSVTSLJYES-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.47 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-3-en-2-yloxy(triethyl)silane;cyclopent-3-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-en-2-yloxy(triethyl)silane;cyclopent-3-en-1-one?
The IUPAC name of but-3-en-2-yloxy(triethyl)silane;cyclopent-3-en-1-one (CID 70572166) is but-3-en-2-yloxy(triethyl)silane;cyclopent-3-en-1-one.
What is the SMILES notation for but-3-en-2-yloxy(triethyl)silane;cyclopent-3-en-1-one?
The canonical SMILES for but-3-en-2-yloxy(triethyl)silane;cyclopent-3-en-1-one is C=CC(C)O[Si](CC)(CC)CC.O=C1CC=CC1.
What is the InChIKey of but-3-en-2-yloxy(triethyl)silane;cyclopent-3-en-1-one?
The InChIKey is CHEYQSVTSLJYES-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22OSi.C5H6O/c1-6-10(5)11-12(7-2,8-3)9-4;6-5-3-1-2-4-5/h6,10H,1,7-9H2,2-5H3;1-2H,3-4H2.
What are the key properties of but-3-en-2-yloxy(triethyl)silane;cyclopent-3-en-1-one?
but-3-en-2-yloxy(triethyl)silane;cyclopent-3-en-1-one has a molecular weight of 268.47 g/mol, XLogP of 4.49, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-en-2-yloxy(triethyl)silane;cyclopent-3-en-1-one is sourced from PubChem (CID 70572166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).