About trans-(1S,2S)-1-(7-ethoxyheptyl)-2-oct-1-enylcyclopentane
trans-(1S,2S)-1-(7-ethoxyheptyl)-2-oct-1-enylcyclopentane (PubChem CID 70572668) has the molecular formula C22H42O
and a molecular weight of 322.58 g/mol. Its IUPAC name is trans-(1S,2S)-1-(7-ethoxyheptyl)-2-oct-1-enylcyclopentane.
Molecular Properties
| Compound Name | trans-(1S,2S)-1-(7-ethoxyheptyl)-2-oct-1-enylcyclopentane |
| PubChem CID | 70572668 |
| Molecular Formula | C22H42O |
| Molecular Weight | 322.58 g/mol |
| Exact Mass | 322.32 |
| IUPAC Name | trans-(1S,2S)-1-(7-ethoxyheptyl)-2-oct-1-enylcyclopentane |
| SMILES | CCCCCCC=C[C@H]1CCC[C@@H]1CCCCCCCOCC |
| InChI | InChI=1S/C22H42O/c1-3-5-6-7-9-12-16-21-18-15-19-22(21)17-13-10-8-11-14-20-23-4-2/h12,16,21-22H,3-11,13-15,17-20H2,1-2H3/t21-,22-/m0/s1 |
| InChIKey | QYRRKVCOOSFCBI-VXKWHMMOSA-N |
| XLogP | 7.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.58 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze trans-(1S,2S)-1-(7-ethoxyheptyl)-2-oct-1-enylcyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,2S)-1-(7-ethoxyheptyl)-2-oct-1-enylcyclopentane?
The IUPAC name of trans-(1S,2S)-1-(7-ethoxyheptyl)-2-oct-1-enylcyclopentane (CID 70572668) is trans-(1S,2S)-1-(7-ethoxyheptyl)-2-oct-1-enylcyclopentane.
What is the SMILES notation for trans-(1S,2S)-1-(7-ethoxyheptyl)-2-oct-1-enylcyclopentane?
The canonical SMILES for trans-(1S,2S)-1-(7-ethoxyheptyl)-2-oct-1-enylcyclopentane is CCCCCCC=C[C@H]1CCC[C@@H]1CCCCCCCOCC.
What is the InChIKey of trans-(1S,2S)-1-(7-ethoxyheptyl)-2-oct-1-enylcyclopentane?
The InChIKey is QYRRKVCOOSFCBI-VXKWHMMOSA-N. The full InChI is InChI=1S/C22H42O/c1-3-5-6-7-9-12-16-21-18-15-19-22(21)17-13-10-8-11-14-20-23-4-2/h12,16,21-22H,3-11,13-15,17-20H2,1-2H3/t21-,22-/m0/s1.
What are the key properties of trans-(1S,2S)-1-(7-ethoxyheptyl)-2-oct-1-enylcyclopentane?
trans-(1S,2S)-1-(7-ethoxyheptyl)-2-oct-1-enylcyclopentane has a molecular weight of 322.58 g/mol, XLogP of 7.31, 15 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,2S)-1-(7-ethoxyheptyl)-2-oct-1-enylcyclopentane is sourced from PubChem (CID 70572668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).