About 5-(3,4-dichlorophenyl)-6-oxo-1H-pyrazine-2,3-dicarbonitrile
5-(3,4-dichlorophenyl)-6-oxo-1H-pyrazine-2,3-dicarbonitrile (PubChem CID 70572741) has the molecular formula C12H4Cl2N4O
and a molecular weight of 291.10 g/mol. Its IUPAC name is 5-(3,4-dichlorophenyl)-6-oxo-1H-pyrazine-2,3-dicarbonitrile.
Molecular Properties
| Compound Name | 5-(3,4-dichlorophenyl)-6-oxo-1H-pyrazine-2,3-dicarbonitrile |
| PubChem CID | 70572741 |
| Molecular Formula | C12H4Cl2N4O |
| Molecular Weight | 291.10 g/mol |
| Exact Mass | 289.98 |
| IUPAC Name | 5-(3,4-dichlorophenyl)-6-oxo-1H-pyrazine-2,3-dicarbonitrile |
| SMILES | N#Cc1nc(-c2ccc(Cl)c(Cl)c2)c(=O)[nH]c1C#N |
| InChI | InChI=1S/C12H4Cl2N4O/c13-7-2-1-6(3-8(7)14)11-12(19)18-10(5-16)9(4-15)17-11/h1-3H,(H,18,19) |
| InChIKey | RHYRJZWLZDILTL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.10 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(3,4-dichlorophenyl)-6-oxo-1H-pyrazine-2,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-dichlorophenyl)-6-oxo-1H-pyrazine-2,3-dicarbonitrile?
The IUPAC name of 5-(3,4-dichlorophenyl)-6-oxo-1H-pyrazine-2,3-dicarbonitrile (CID 70572741) is 5-(3,4-dichlorophenyl)-6-oxo-1H-pyrazine-2,3-dicarbonitrile.
What is the SMILES notation for 5-(3,4-dichlorophenyl)-6-oxo-1H-pyrazine-2,3-dicarbonitrile?
The canonical SMILES for 5-(3,4-dichlorophenyl)-6-oxo-1H-pyrazine-2,3-dicarbonitrile is N#Cc1nc(-c2ccc(Cl)c(Cl)c2)c(=O)[nH]c1C#N.
What is the InChIKey of 5-(3,4-dichlorophenyl)-6-oxo-1H-pyrazine-2,3-dicarbonitrile?
The InChIKey is RHYRJZWLZDILTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H4Cl2N4O/c13-7-2-1-6(3-8(7)14)11-12(19)18-10(5-16)9(4-15)17-11/h1-3H,(H,18,19).
What are the key properties of 5-(3,4-dichlorophenyl)-6-oxo-1H-pyrazine-2,3-dicarbonitrile?
5-(3,4-dichlorophenyl)-6-oxo-1H-pyrazine-2,3-dicarbonitrile has a molecular weight of 291.10 g/mol, XLogP of 2.49, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-dichlorophenyl)-6-oxo-1H-pyrazine-2,3-dicarbonitrile is sourced from PubChem (CID 70572741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).