About 1-[(6Z)-4-methyl-6-pyrrolidin-2-ylidenecyclohexa-2,4-dien-1-yl]ethanone
1-[(6Z)-4-methyl-6-pyrrolidin-2-ylidenecyclohexa-2,4-dien-1-yl]ethanone (PubChem CID 70572792) has the molecular formula C13H17NO
and a molecular weight of 203.28 g/mol. Its IUPAC name is 1-[(6Z)-4-methyl-6-pyrrolidin-2-ylidenecyclohexa-2,4-dien-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[(6Z)-4-methyl-6-pyrrolidin-2-ylidenecyclohexa-2,4-dien-1-yl]ethanone |
| PubChem CID | 70572792 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 1-[(6Z)-4-methyl-6-pyrrolidin-2-ylidenecyclohexa-2,4-dien-1-yl]ethanone |
| SMILES | CC(=O)C1C=CC(C)=C/C1=C1\CCCN1 |
| InChI | InChI=1S/C13H17NO/c1-9-5-6-11(10(2)15)12(8-9)13-4-3-7-14-13/h5-6,8,11,14H,3-4,7H2,1-2H3/b13-12- |
| InChIKey | LABXQLXTELKSMQ-SEYXRHQNSA-N |
| XLogP | 2.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(6Z)-4-methyl-6-pyrrolidin-2-ylidenecyclohexa-2,4-dien-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(6Z)-4-methyl-6-pyrrolidin-2-ylidenecyclohexa-2,4-dien-1-yl]ethanone?
The IUPAC name of 1-[(6Z)-4-methyl-6-pyrrolidin-2-ylidenecyclohexa-2,4-dien-1-yl]ethanone (CID 70572792) is 1-[(6Z)-4-methyl-6-pyrrolidin-2-ylidenecyclohexa-2,4-dien-1-yl]ethanone.
What is the SMILES notation for 1-[(6Z)-4-methyl-6-pyrrolidin-2-ylidenecyclohexa-2,4-dien-1-yl]ethanone?
The canonical SMILES for 1-[(6Z)-4-methyl-6-pyrrolidin-2-ylidenecyclohexa-2,4-dien-1-yl]ethanone is CC(=O)C1C=CC(C)=C/C1=C1\CCCN1.
What is the InChIKey of 1-[(6Z)-4-methyl-6-pyrrolidin-2-ylidenecyclohexa-2,4-dien-1-yl]ethanone?
The InChIKey is LABXQLXTELKSMQ-SEYXRHQNSA-N. The full InChI is InChI=1S/C13H17NO/c1-9-5-6-11(10(2)15)12(8-9)13-4-3-7-14-13/h5-6,8,11,14H,3-4,7H2,1-2H3/b13-12-.
What are the key properties of 1-[(6Z)-4-methyl-6-pyrrolidin-2-ylidenecyclohexa-2,4-dien-1-yl]ethanone?
1-[(6Z)-4-methyl-6-pyrrolidin-2-ylidenecyclohexa-2,4-dien-1-yl]ethanone has a molecular weight of 203.28 g/mol, XLogP of 2.35, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(6Z)-4-methyl-6-pyrrolidin-2-ylidenecyclohexa-2,4-dien-1-yl]ethanone is sourced from PubChem (CID 70572792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).