About 3,5-dimethyl-1-propan-2-yl-3H-pyrazole-2,4-diamine
3,5-dimethyl-1-propan-2-yl-3H-pyrazole-2,4-diamine (PubChem CID 70572818) has the molecular formula C8H18N4
and a molecular weight of 170.26 g/mol. Its IUPAC name is 3,5-dimethyl-1-propan-2-yl-3H-pyrazole-2,4-diamine.
Molecular Properties
| Compound Name | 3,5-dimethyl-1-propan-2-yl-3H-pyrazole-2,4-diamine |
| PubChem CID | 70572818 |
| Molecular Formula | C8H18N4 |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.15 |
| IUPAC Name | 3,5-dimethyl-1-propan-2-yl-3H-pyrazole-2,4-diamine |
| SMILES | CC1=C(N)C(C)N(N)N1C(C)C |
| InChI | InChI=1S/C8H18N4/c1-5(2)11-6(3)8(9)7(4)12(11)10/h5,7H,9-10H2,1-4H3 |
| InChIKey | LGJKHHVEGSTJKI-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dimethyl-1-propan-2-yl-3H-pyrazole-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-1-propan-2-yl-3H-pyrazole-2,4-diamine?
The IUPAC name of 3,5-dimethyl-1-propan-2-yl-3H-pyrazole-2,4-diamine (CID 70572818) is 3,5-dimethyl-1-propan-2-yl-3H-pyrazole-2,4-diamine.
What is the SMILES notation for 3,5-dimethyl-1-propan-2-yl-3H-pyrazole-2,4-diamine?
The canonical SMILES for 3,5-dimethyl-1-propan-2-yl-3H-pyrazole-2,4-diamine is CC1=C(N)C(C)N(N)N1C(C)C.
What is the InChIKey of 3,5-dimethyl-1-propan-2-yl-3H-pyrazole-2,4-diamine?
The InChIKey is LGJKHHVEGSTJKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N4/c1-5(2)11-6(3)8(9)7(4)12(11)10/h5,7H,9-10H2,1-4H3.
What are the key properties of 3,5-dimethyl-1-propan-2-yl-3H-pyrazole-2,4-diamine?
3,5-dimethyl-1-propan-2-yl-3H-pyrazole-2,4-diamine has a molecular weight of 170.26 g/mol, XLogP of 0.38, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-1-propan-2-yl-3H-pyrazole-2,4-diamine is sourced from PubChem (CID 70572818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).