About N-(2-sulfamoyl-1,3-thiazol-5-yl)acetamide
N-(2-sulfamoyl-1,3-thiazol-5-yl)acetamide (PubChem CID 70573476) has the molecular formula C5H7N3O3S2
and a molecular weight of 221.26 g/mol. Its IUPAC name is N-(2-sulfamoyl-1,3-thiazol-5-yl)acetamide.
Molecular Properties
| Compound Name | N-(2-sulfamoyl-1,3-thiazol-5-yl)acetamide |
| PubChem CID | 70573476 |
| Molecular Formula | C5H7N3O3S2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 220.99 |
| IUPAC Name | N-(2-sulfamoyl-1,3-thiazol-5-yl)acetamide |
| SMILES | CC(=O)Nc1cnc(S(N)(=O)=O)s1 |
| InChI | InChI=1S/C5H7N3O3S2/c1-3(9)8-4-2-7-5(12-4)13(6,10)11/h2H,1H3,(H,8,9)(H2,6,10,11) |
| InChIKey | CEGJNUDFPDAUCC-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2-sulfamoyl-1,3-thiazol-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-sulfamoyl-1,3-thiazol-5-yl)acetamide?
The IUPAC name of N-(2-sulfamoyl-1,3-thiazol-5-yl)acetamide (CID 70573476) is N-(2-sulfamoyl-1,3-thiazol-5-yl)acetamide.
What is the SMILES notation for N-(2-sulfamoyl-1,3-thiazol-5-yl)acetamide?
The canonical SMILES for N-(2-sulfamoyl-1,3-thiazol-5-yl)acetamide is CC(=O)Nc1cnc(S(N)(=O)=O)s1.
What is the InChIKey of N-(2-sulfamoyl-1,3-thiazol-5-yl)acetamide?
The InChIKey is CEGJNUDFPDAUCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3O3S2/c1-3(9)8-4-2-7-5(12-4)13(6,10)11/h2H,1H3,(H,8,9)(H2,6,10,11).
What are the key properties of N-(2-sulfamoyl-1,3-thiazol-5-yl)acetamide?
N-(2-sulfamoyl-1,3-thiazol-5-yl)acetamide has a molecular weight of 221.26 g/mol, XLogP of -0.25, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-sulfamoyl-1,3-thiazol-5-yl)acetamide is sourced from PubChem (CID 70573476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).