C28H34N2 — CID 70573930
2-N,2-N,7-N,7-N-tetrakis(prop-2-enyl)-1,3a,4,5,8,10-hexahydropyrene-2,7-diamine (PubChem CID 70573930) has the molecular formula C28H34N2 and a molecular weight of 398.59 g/mol. Its IUPAC name is 2-N,2-N,7-N,7-N-tetrakis(prop-2-enyl)-1,3a,4,5,8,10-hexahydropyrene-2,7-diamine.
| Compound Name | 2-N,2-N,7-N,7-N-tetrakis(prop-2-enyl)-1,3a,4,5,8,10-hexahydropyrene-2,7-diamine |
|---|---|
| PubChem CID | 70573930 |
| Molecular Formula | C28H34N2 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | 2-N,2-N,7-N,7-N-tetrakis(prop-2-enyl)-1,3a,4,5,8,10-hexahydropyrene-2,7-diamine |
| SMILES | C=CCN(CC=C)C1=CC2=C3C(=CCC4=C3C(C=C(N(CC=C)CC=C)C4)CC2)C1 |
| InChI | InChI=1S/C28H34N2/c1-5-13-29(14-6-2)25-17-21-9-11-23-19-26(30(15-7-3)16-8-4)20-24-12-10-22(18-25)27(21)28(23)24/h5-9,18,20,24H,1-4,10-17,19H2 |
| InChIKey | SYZYHQLPNNCBKB-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|