C21H36O5 — CID 70574031
(2R,3R,4R)-4-hydroxy-3-[(E)-3-hydroxyoct-1-enyl]-2-(8-hydroxy-7-oxooctyl)cyclopentan-1-one (PubChem CID 70574031) has the molecular formula C21H36O5 and a molecular weight of 368.51 g/mol. Its IUPAC name is (2R,3R,4R)-4-hydroxy-3-[(E)-3-hydroxyoct-1-enyl]-2-(8-hydroxy-7-oxooctyl)cyclopentan-1-one.
| Compound Name | (2R,3R,4R)-4-hydroxy-3-[(E)-3-hydroxyoct-1-enyl]-2-(8-hydroxy-7-oxooctyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 70574031 |
| Molecular Formula | C21H36O5 |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | (2R,3R,4R)-4-hydroxy-3-[(E)-3-hydroxyoct-1-enyl]-2-(8-hydroxy-7-oxooctyl)cyclopentan-1-one |
| SMILES | CCCCCC(O)/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCCCC(=O)CO |
| InChI | InChI=1S/C21H36O5/c1-2-3-6-9-16(23)12-13-19-18(20(25)14-21(19)26)11-8-5-4-7-10-17(24)15-22/h12-13,16,18-19,21-23,26H,2-11,14-15H2,1H3/b13-12+/t16?,18-,19-,21-/m1/s1 |
| InChIKey | UTUBCGQHVOPCGX-GKYSQEDBSA-N |
| XLogP | 2.95 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|