About N-[(E)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-yl]-1-methylcyclohexan-1-amine
N-[(E)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-yl]-1-methylcyclohexan-1-amine (PubChem CID 70574446) has the molecular formula C14H24N2
and a molecular weight of 220.36 g/mol. Its IUPAC name is N-[(E)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-yl]-1-methylcyclohexan-1-amine.
Molecular Properties
| Compound Name | N-[(E)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-yl]-1-methylcyclohexan-1-amine |
| PubChem CID | 70574446 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | N-[(E)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-yl]-1-methylcyclohexan-1-amine |
| SMILES | C/C(=C\C1=NCCC1)NC1(C)CCCCC1 |
| InChI | InChI=1S/C14H24N2/c1-12(11-13-7-6-10-15-13)16-14(2)8-4-3-5-9-14/h11,16H,3-10H2,1-2H3/b12-11+ |
| InChIKey | VJQZWHNHCQLREE-VAWYXSNFSA-N |
| XLogP | 3.44 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(E)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-yl]-1-methylcyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-yl]-1-methylcyclohexan-1-amine?
The IUPAC name of N-[(E)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-yl]-1-methylcyclohexan-1-amine (CID 70574446) is N-[(E)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-yl]-1-methylcyclohexan-1-amine.
What is the SMILES notation for N-[(E)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-yl]-1-methylcyclohexan-1-amine?
The canonical SMILES for N-[(E)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-yl]-1-methylcyclohexan-1-amine is C/C(=C\C1=NCCC1)NC1(C)CCCCC1.
What is the InChIKey of N-[(E)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-yl]-1-methylcyclohexan-1-amine?
The InChIKey is VJQZWHNHCQLREE-VAWYXSNFSA-N. The full InChI is InChI=1S/C14H24N2/c1-12(11-13-7-6-10-15-13)16-14(2)8-4-3-5-9-14/h11,16H,3-10H2,1-2H3/b12-11+.
What are the key properties of N-[(E)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-yl]-1-methylcyclohexan-1-amine?
N-[(E)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-yl]-1-methylcyclohexan-1-amine has a molecular weight of 220.36 g/mol, XLogP of 3.44, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-1-(3,4-dihydro-2H-pyrrol-5-yl)prop-1-en-2-yl]-1-methylcyclohexan-1-amine is sourced from PubChem (CID 70574446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).