C27H22N2O2 — CID 70574558
1,1'-biphenyl;5,5-diphenylimidazolidine-2,4-dione (PubChem CID 70574558) has the molecular formula C27H22N2O2 and a molecular weight of 406.49 g/mol. Its IUPAC name is 1,1'-biphenyl;5,5-diphenylimidazolidine-2,4-dione.
| Compound Name | 1,1'-biphenyl;5,5-diphenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 70574558 |
| Molecular Formula | C27H22N2O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 1,1'-biphenyl;5,5-diphenylimidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(c2ccccc2)(c2ccccc2)N1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C15H12N2O2.C12H10/c18-13-15(17-14(19)16-13,11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1-10H,(H2,16,17,18,19);1-10H |
| InChIKey | VXYDVUDDBBHQAA-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|