About 3-ethyl-4,5-dipentyl-1,2,4-triazole
3-ethyl-4,5-dipentyl-1,2,4-triazole (PubChem CID 70574575) has the molecular formula C14H27N3
and a molecular weight of 237.39 g/mol. Its IUPAC name is 3-ethyl-4,5-dipentyl-1,2,4-triazole.
Molecular Properties
| Compound Name | 3-ethyl-4,5-dipentyl-1,2,4-triazole |
| PubChem CID | 70574575 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | 3-ethyl-4,5-dipentyl-1,2,4-triazole |
| SMILES | CCCCCc1nnc(CC)n1CCCCC |
| InChI | InChI=1S/C14H27N3/c1-4-7-9-11-14-16-15-13(6-3)17(14)12-10-8-5-2/h4-12H2,1-3H3 |
| InChIKey | HTXUSSRSIDYOFH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-4,5-dipentyl-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-4,5-dipentyl-1,2,4-triazole?
The IUPAC name of 3-ethyl-4,5-dipentyl-1,2,4-triazole (CID 70574575) is 3-ethyl-4,5-dipentyl-1,2,4-triazole.
What is the SMILES notation for 3-ethyl-4,5-dipentyl-1,2,4-triazole?
The canonical SMILES for 3-ethyl-4,5-dipentyl-1,2,4-triazole is CCCCCc1nnc(CC)n1CCCCC.
What is the InChIKey of 3-ethyl-4,5-dipentyl-1,2,4-triazole?
The InChIKey is HTXUSSRSIDYOFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27N3/c1-4-7-9-11-14-16-15-13(6-3)17(14)12-10-8-5-2/h4-12H2,1-3H3.
What are the key properties of 3-ethyl-4,5-dipentyl-1,2,4-triazole?
3-ethyl-4,5-dipentyl-1,2,4-triazole has a molecular weight of 237.39 g/mol, XLogP of 3.76, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-4,5-dipentyl-1,2,4-triazole is sourced from PubChem (CID 70574575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).