C8H6Cl4O2 — CID 7057469
(1R,5S)-2,2,4,4-tetrachloro-1-methyl-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 7057469) has the molecular formula C8H6Cl4O2 and a molecular weight of 275.95 g/mol. Its IUPAC name is (1R,5S)-2,2,4,4-tetrachloro-1-methyl-8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | (1R,5S)-2,2,4,4-tetrachloro-1-methyl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 7057469 |
| Molecular Formula | C8H6Cl4O2 |
| Molecular Weight | 275.95 g/mol |
| Exact Mass | 273.91 |
| IUPAC Name | (1R,5S)-2,2,4,4-tetrachloro-1-methyl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | C[C@]12C=C[C@H](O1)C(Cl)(Cl)C(=O)C2(Cl)Cl |
| InChI | InChI=1S/C8H6Cl4O2/c1-6-3-2-4(14-6)7(9,10)5(13)8(6,11)12/h2-4H,1H3/t4-,6+/m0/s1 |
| InChIKey | IGAOABLZAVXKOK-UJURSFKZSA-N |
| XLogP | 2.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.95 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|