C12H12Cl4O2 — CID 7057471
(1R,5S)-1-but-3-enyl-2,2,4,4-tetrachloro-7-methyl-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 7057471) has the molecular formula C12H12Cl4O2 and a molecular weight of 330.04 g/mol. Its IUPAC name is (1R,5S)-1-but-3-enyl-2,2,4,4-tetrachloro-7-methyl-8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | (1R,5S)-1-but-3-enyl-2,2,4,4-tetrachloro-7-methyl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 7057471 |
| Molecular Formula | C12H12Cl4O2 |
| Molecular Weight | 330.04 g/mol |
| Exact Mass | 327.96 |
| IUPAC Name | (1R,5S)-1-but-3-enyl-2,2,4,4-tetrachloro-7-methyl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | C=CCC[C@@]12O[C@@H](C=C1C)C(Cl)(Cl)C(=O)C2(Cl)Cl |
| InChI | InChI=1S/C12H12Cl4O2/c1-3-4-5-10-7(2)6-8(18-10)11(13,14)9(17)12(10,15)16/h3,6,8H,1,4-5H2,2H3/t8-,10+/m0/s1 |
| InChIKey | XYVHULQKIYPAMT-WCBMZHEXSA-N |
| XLogP | 3.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.04 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|