About 2-ethyl-3-(3-oxobutyl)-2,3-dihydrochromen-4-one;piperidine
2-ethyl-3-(3-oxobutyl)-2,3-dihydrochromen-4-one;piperidine (PubChem CID 70574721) has the molecular formula C20H29NO3
and a molecular weight of 331.46 g/mol. Its IUPAC name is 2-ethyl-3-(3-oxobutyl)-2,3-dihydrochromen-4-one;piperidine.
Molecular Properties
| Compound Name | 2-ethyl-3-(3-oxobutyl)-2,3-dihydrochromen-4-one;piperidine |
| PubChem CID | 70574721 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | 2-ethyl-3-(3-oxobutyl)-2,3-dihydrochromen-4-one;piperidine |
| SMILES | C1CCNCC1.CCC1Oc2ccccc2C(=O)C1CCC(C)=O |
| InChI | InChI=1S/C15H18O3.C5H11N/c1-3-13-12(9-8-10(2)16)15(17)11-6-4-5-7-14(11)18-13;1-2-4-6-5-3-1/h4-7,12-13H,3,8-9H2,1-2H3;6H,1-5H2 |
| InChIKey | XXFZEMMIGWJDHB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethyl-3-(3-oxobutyl)-2,3-dihydrochromen-4-one;piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-3-(3-oxobutyl)-2,3-dihydrochromen-4-one;piperidine?
The IUPAC name of 2-ethyl-3-(3-oxobutyl)-2,3-dihydrochromen-4-one;piperidine (CID 70574721) is 2-ethyl-3-(3-oxobutyl)-2,3-dihydrochromen-4-one;piperidine.
What is the SMILES notation for 2-ethyl-3-(3-oxobutyl)-2,3-dihydrochromen-4-one;piperidine?
The canonical SMILES for 2-ethyl-3-(3-oxobutyl)-2,3-dihydrochromen-4-one;piperidine is C1CCNCC1.CCC1Oc2ccccc2C(=O)C1CCC(C)=O.
What is the InChIKey of 2-ethyl-3-(3-oxobutyl)-2,3-dihydrochromen-4-one;piperidine?
The InChIKey is XXFZEMMIGWJDHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18O3.C5H11N/c1-3-13-12(9-8-10(2)16)15(17)11-6-4-5-7-14(11)18-13;1-2-4-6-5-3-1/h4-7,12-13H,3,8-9H2,1-2H3;6H,1-5H2.
What are the key properties of 2-ethyl-3-(3-oxobutyl)-2,3-dihydrochromen-4-one;piperidine?
2-ethyl-3-(3-oxobutyl)-2,3-dihydrochromen-4-one;piperidine has a molecular weight of 331.46 g/mol, XLogP of 3.79, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3-(3-oxobutyl)-2,3-dihydrochromen-4-one;piperidine is sourced from PubChem (CID 70574721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).