C13H14Cl4O2 — CID 7057473
(1R,5S)-2,2,4,4-tetrachloro-7-methyl-1-(3-methylbut-3-enyl)-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 7057473) has the molecular formula C13H14Cl4O2 and a molecular weight of 344.07 g/mol. Its IUPAC name is (1R,5S)-2,2,4,4-tetrachloro-7-methyl-1-(3-methylbut-3-enyl)-8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | (1R,5S)-2,2,4,4-tetrachloro-7-methyl-1-(3-methylbut-3-enyl)-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 7057473 |
| Molecular Formula | C13H14Cl4O2 |
| Molecular Weight | 344.07 g/mol |
| Exact Mass | 341.97 |
| IUPAC Name | (1R,5S)-2,2,4,4-tetrachloro-7-methyl-1-(3-methylbut-3-enyl)-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | C=C(C)CC[C@@]12O[C@@H](C=C1C)C(Cl)(Cl)C(=O)C2(Cl)Cl |
| InChI | InChI=1S/C13H14Cl4O2/c1-7(2)4-5-11-8(3)6-9(19-11)12(14,15)10(18)13(11,16)17/h6,9H,1,4-5H2,2-3H3/t9-,11+/m0/s1 |
| InChIKey | JQOCZZPQCHHVLC-GXSJLCMTSA-N |
| XLogP | 4.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.07 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|