C50H52N2O2 — CID 70574775
2,3-dimethyl-1-N,1-N,4-N,4-N-tetrakis[(2-prop-2-enylphenyl)methyl]benzene-1,4-dicarboxamide (PubChem CID 70574775) has the molecular formula C50H52N2O2 and a molecular weight of 712.98 g/mol. Its IUPAC name is 2,3-dimethyl-1-N,1-N,4-N,4-N-tetrakis[(2-prop-2-enylphenyl)methyl]benzene-1,4-dicarboxamide.
| Compound Name | 2,3-dimethyl-1-N,1-N,4-N,4-N-tetrakis[(2-prop-2-enylphenyl)methyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 70574775 |
| Molecular Formula | C50H52N2O2 |
| Molecular Weight | 712.98 g/mol |
| Exact Mass | 712.40 |
| IUPAC Name | 2,3-dimethyl-1-N,1-N,4-N,4-N-tetrakis[(2-prop-2-enylphenyl)methyl]benzene-1,4-dicarboxamide |
| SMILES | C=CCc1ccccc1CN(Cc1ccccc1CC=C)C(=O)c1ccc(C(=O)N(Cc2ccccc2CC=C)Cc2ccccc2CC=C)c(C)c1C |
| InChI | InChI=1S/C50H52N2O2/c1-7-19-39-23-11-15-27-43(39)33-51(34-44-28-16-12-24-40(44)20-8-2)49(53)47-31-32-48(38(6)37(47)5)50(54)52(35-45-29-17-13-25-41(45)21-9-3)36-46-30-18-14-26-42(46)22-10-4/h7-18,23-32H,1-4,19-22,33-36H2,5-6H3 |
| InChIKey | ZEQWSGAPEBFTQC-UHFFFAOYSA-N |
| XLogP | 10.90 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.98 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|