About 1,3-ditert-butyl-5-(3,5-ditert-butylphenyl)sulfinylbenzene
1,3-ditert-butyl-5-(3,5-ditert-butylphenyl)sulfinylbenzene (PubChem CID 70574918) has the molecular formula C28H42OS
and a molecular weight of 426.71 g/mol. Its IUPAC name is 1,3-ditert-butyl-5-(3,5-ditert-butylphenyl)sulfinylbenzene.
Molecular Properties
| Compound Name | 1,3-ditert-butyl-5-(3,5-ditert-butylphenyl)sulfinylbenzene |
| PubChem CID | 70574918 |
| Molecular Formula | C28H42OS |
| Molecular Weight | 426.71 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | 1,3-ditert-butyl-5-(3,5-ditert-butylphenyl)sulfinylbenzene |
| SMILES | CC(C)(C)c1cc(S(=O)c2cc(C(C)(C)C)cc(C(C)(C)C)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C28H42OS/c1-25(2,3)19-13-20(26(4,5)6)16-23(15-19)30(29)24-17-21(27(7,8)9)14-22(18-24)28(10,11)12/h13-18H,1-12H3 |
| InChIKey | GXLUUEHTBXLKRT-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.71 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,3-ditert-butyl-5-(3,5-ditert-butylphenyl)sulfinylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-ditert-butyl-5-(3,5-ditert-butylphenyl)sulfinylbenzene?
The IUPAC name of 1,3-ditert-butyl-5-(3,5-ditert-butylphenyl)sulfinylbenzene (CID 70574918) is 1,3-ditert-butyl-5-(3,5-ditert-butylphenyl)sulfinylbenzene.
What is the SMILES notation for 1,3-ditert-butyl-5-(3,5-ditert-butylphenyl)sulfinylbenzene?
The canonical SMILES for 1,3-ditert-butyl-5-(3,5-ditert-butylphenyl)sulfinylbenzene is CC(C)(C)c1cc(S(=O)c2cc(C(C)(C)C)cc(C(C)(C)C)c2)cc(C(C)(C)C)c1.
What is the InChIKey of 1,3-ditert-butyl-5-(3,5-ditert-butylphenyl)sulfinylbenzene?
The InChIKey is GXLUUEHTBXLKRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H42OS/c1-25(2,3)19-13-20(26(4,5)6)16-23(15-19)30(29)24-17-21(27(7,8)9)14-22(18-24)28(10,11)12/h13-18H,1-12H3.
What are the key properties of 1,3-ditert-butyl-5-(3,5-ditert-butylphenyl)sulfinylbenzene?
1,3-ditert-butyl-5-(3,5-ditert-butylphenyl)sulfinylbenzene has a molecular weight of 426.71 g/mol, XLogP of 8.04, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-ditert-butyl-5-(3,5-ditert-butylphenyl)sulfinylbenzene is sourced from PubChem (CID 70574918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).