About 2-ethyl-2,4-bis(2-methylsulfonylethyl)-4H-chromen-3-one;piperidine
2-ethyl-2,4-bis(2-methylsulfonylethyl)-4H-chromen-3-one;piperidine (PubChem CID 70574974) has the molecular formula C22H35NO6S2
and a molecular weight of 473.66 g/mol. Its IUPAC name is 2-ethyl-2,4-bis(2-methylsulfonylethyl)-4H-chromen-3-one;piperidine.
Molecular Properties
| Compound Name | 2-ethyl-2,4-bis(2-methylsulfonylethyl)-4H-chromen-3-one;piperidine |
| PubChem CID | 70574974 |
| Molecular Formula | C22H35NO6S2 |
| Molecular Weight | 473.66 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 2-ethyl-2,4-bis(2-methylsulfonylethyl)-4H-chromen-3-one;piperidine |
| SMILES | C1CCNCC1.CCC1(CCS(C)(=O)=O)Oc2ccccc2C(CCS(C)(=O)=O)C1=O |
| InChI | InChI=1S/C17H24O6S2.C5H11N/c1-4-17(10-12-25(3,21)22)16(18)14(9-11-24(2,19)20)13-7-5-6-8-15(13)23-17;1-2-4-6-5-3-1/h5-8,14H,4,9-12H2,1-3H3;6H,1-5H2 |
| InChIKey | ZEUFQCQEEHKCHM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 473.66 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-ethyl-2,4-bis(2-methylsulfonylethyl)-4H-chromen-3-one;piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2,4-bis(2-methylsulfonylethyl)-4H-chromen-3-one;piperidine?
The IUPAC name of 2-ethyl-2,4-bis(2-methylsulfonylethyl)-4H-chromen-3-one;piperidine (CID 70574974) is 2-ethyl-2,4-bis(2-methylsulfonylethyl)-4H-chromen-3-one;piperidine.
What is the SMILES notation for 2-ethyl-2,4-bis(2-methylsulfonylethyl)-4H-chromen-3-one;piperidine?
The canonical SMILES for 2-ethyl-2,4-bis(2-methylsulfonylethyl)-4H-chromen-3-one;piperidine is C1CCNCC1.CCC1(CCS(C)(=O)=O)Oc2ccccc2C(CCS(C)(=O)=O)C1=O.
What is the InChIKey of 2-ethyl-2,4-bis(2-methylsulfonylethyl)-4H-chromen-3-one;piperidine?
The InChIKey is ZEUFQCQEEHKCHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O6S2.C5H11N/c1-4-17(10-12-25(3,21)22)16(18)14(9-11-24(2,19)20)13-7-5-6-8-15(13)23-17;1-2-4-6-5-3-1/h5-8,14H,4,9-12H2,1-3H3;6H,1-5H2.
What are the key properties of 2-ethyl-2,4-bis(2-methylsulfonylethyl)-4H-chromen-3-one;piperidine?
2-ethyl-2,4-bis(2-methylsulfonylethyl)-4H-chromen-3-one;piperidine has a molecular weight of 473.66 g/mol, XLogP of 2.51, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2,4-bis(2-methylsulfonylethyl)-4H-chromen-3-one;piperidine is sourced from PubChem (CID 70574974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).