About 2-methyl-3,3-bis(2-methylsulfonylethyl)-2-(3-morpholin-4-ylpropyl)chromen-4-one
2-methyl-3,3-bis(2-methylsulfonylethyl)-2-(3-morpholin-4-ylpropyl)chromen-4-one (PubChem CID 70575119) has the molecular formula C23H35NO7S2
and a molecular weight of 501.67 g/mol. Its IUPAC name is 2-methyl-3,3-bis(2-methylsulfonylethyl)-2-(3-morpholin-4-ylpropyl)chromen-4-one.
Molecular Properties
| Compound Name | 2-methyl-3,3-bis(2-methylsulfonylethyl)-2-(3-morpholin-4-ylpropyl)chromen-4-one |
| PubChem CID | 70575119 |
| Molecular Formula | C23H35NO7S2 |
| Molecular Weight | 501.67 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | 2-methyl-3,3-bis(2-methylsulfonylethyl)-2-(3-morpholin-4-ylpropyl)chromen-4-one |
| SMILES | CC1(CCCN2CCOCC2)Oc2ccccc2C(=O)C1(CCS(C)(=O)=O)CCS(C)(=O)=O |
| InChI | InChI=1S/C23H35NO7S2/c1-22(9-6-12-24-13-15-30-16-14-24)23(10-17-32(2,26)27,11-18-33(3,28)29)21(25)19-7-4-5-8-20(19)31-22/h4-5,7-8H,6,9-18H2,1-3H3 |
| InChIKey | ACPRVFXKWZNPNB-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 501.67 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-methyl-3,3-bis(2-methylsulfonylethyl)-2-(3-morpholin-4-ylpropyl)chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3,3-bis(2-methylsulfonylethyl)-2-(3-morpholin-4-ylpropyl)chromen-4-one?
The IUPAC name of 2-methyl-3,3-bis(2-methylsulfonylethyl)-2-(3-morpholin-4-ylpropyl)chromen-4-one (CID 70575119) is 2-methyl-3,3-bis(2-methylsulfonylethyl)-2-(3-morpholin-4-ylpropyl)chromen-4-one.
What is the SMILES notation for 2-methyl-3,3-bis(2-methylsulfonylethyl)-2-(3-morpholin-4-ylpropyl)chromen-4-one?
The canonical SMILES for 2-methyl-3,3-bis(2-methylsulfonylethyl)-2-(3-morpholin-4-ylpropyl)chromen-4-one is CC1(CCCN2CCOCC2)Oc2ccccc2C(=O)C1(CCS(C)(=O)=O)CCS(C)(=O)=O.
What is the InChIKey of 2-methyl-3,3-bis(2-methylsulfonylethyl)-2-(3-morpholin-4-ylpropyl)chromen-4-one?
The InChIKey is ACPRVFXKWZNPNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H35NO7S2/c1-22(9-6-12-24-13-15-30-16-14-24)23(10-17-32(2,26)27,11-18-33(3,28)29)21(25)19-7-4-5-8-20(19)31-22/h4-5,7-8H,6,9-18H2,1-3H3.
What are the key properties of 2-methyl-3,3-bis(2-methylsulfonylethyl)-2-(3-morpholin-4-ylpropyl)chromen-4-one?
2-methyl-3,3-bis(2-methylsulfonylethyl)-2-(3-morpholin-4-ylpropyl)chromen-4-one has a molecular weight of 501.67 g/mol, XLogP of 1.99, 10 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3,3-bis(2-methylsulfonylethyl)-2-(3-morpholin-4-ylpropyl)chromen-4-one is sourced from PubChem (CID 70575119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).