About 2-methyl-4,4-bis(2-methylsulfonylethyl)-2-propylchromen-3-one;morpholine
2-methyl-4,4-bis(2-methylsulfonylethyl)-2-propylchromen-3-one;morpholine (PubChem CID 70575120) has the molecular formula C23H37NO7S2
and a molecular weight of 503.68 g/mol. Its IUPAC name is 2-methyl-4,4-bis(2-methylsulfonylethyl)-2-propylchromen-3-one;morpholine.
Molecular Properties
| Compound Name | 2-methyl-4,4-bis(2-methylsulfonylethyl)-2-propylchromen-3-one;morpholine |
| PubChem CID | 70575120 |
| Molecular Formula | C23H37NO7S2 |
| Molecular Weight | 503.68 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | 2-methyl-4,4-bis(2-methylsulfonylethyl)-2-propylchromen-3-one;morpholine |
| SMILES | C1COCCN1.CCCC1(C)Oc2ccccc2C(CCS(C)(=O)=O)(CCS(C)(=O)=O)C1=O |
| InChI | InChI=1S/C19H28O6S2.C4H9NO/c1-5-10-18(2)17(20)19(11-13-26(3,21)22,12-14-27(4,23)24)15-8-6-7-9-16(15)25-18;1-3-6-4-2-5-1/h6-9H,5,10-14H2,1-4H3;5H,1-4H2 |
| InChIKey | ROBDNCNKKYYOBT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 503.68 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-methyl-4,4-bis(2-methylsulfonylethyl)-2-propylchromen-3-one;morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4,4-bis(2-methylsulfonylethyl)-2-propylchromen-3-one;morpholine?
The IUPAC name of 2-methyl-4,4-bis(2-methylsulfonylethyl)-2-propylchromen-3-one;morpholine (CID 70575120) is 2-methyl-4,4-bis(2-methylsulfonylethyl)-2-propylchromen-3-one;morpholine.
What is the SMILES notation for 2-methyl-4,4-bis(2-methylsulfonylethyl)-2-propylchromen-3-one;morpholine?
The canonical SMILES for 2-methyl-4,4-bis(2-methylsulfonylethyl)-2-propylchromen-3-one;morpholine is C1COCCN1.CCCC1(C)Oc2ccccc2C(CCS(C)(=O)=O)(CCS(C)(=O)=O)C1=O.
What is the InChIKey of 2-methyl-4,4-bis(2-methylsulfonylethyl)-2-propylchromen-3-one;morpholine?
The InChIKey is ROBDNCNKKYYOBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28O6S2.C4H9NO/c1-5-10-18(2)17(20)19(11-13-26(3,21)22,12-14-27(4,23)24)15-8-6-7-9-16(15)25-18;1-3-6-4-2-5-1/h6-9H,5,10-14H2,1-4H3;5H,1-4H2.
What are the key properties of 2-methyl-4,4-bis(2-methylsulfonylethyl)-2-propylchromen-3-one;morpholine?
2-methyl-4,4-bis(2-methylsulfonylethyl)-2-propylchromen-3-one;morpholine has a molecular weight of 503.68 g/mol, XLogP of 1.92, 8 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4,4-bis(2-methylsulfonylethyl)-2-propylchromen-3-one;morpholine is sourced from PubChem (CID 70575120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).