About 2-methyl-4,4-bis(2-methylsulfonylethyl)-2-propylchromen-3-one
2-methyl-4,4-bis(2-methylsulfonylethyl)-2-propylchromen-3-one (PubChem CID 70575121) has the molecular formula C19H28O6S2
and a molecular weight of 416.56 g/mol. Its IUPAC name is 2-methyl-4,4-bis(2-methylsulfonylethyl)-2-propylchromen-3-one.
Molecular Properties
| Compound Name | 2-methyl-4,4-bis(2-methylsulfonylethyl)-2-propylchromen-3-one |
| PubChem CID | 70575121 |
| Molecular Formula | C19H28O6S2 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 2-methyl-4,4-bis(2-methylsulfonylethyl)-2-propylchromen-3-one |
| SMILES | CCCC1(C)Oc2ccccc2C(CCS(C)(=O)=O)(CCS(C)(=O)=O)C1=O |
| InChI | InChI=1S/C19H28O6S2/c1-5-10-18(2)17(20)19(11-13-26(3,21)22,12-14-27(4,23)24)15-8-6-7-9-16(15)25-18/h6-9H,5,10-14H2,1-4H3 |
| InChIKey | NIZSXSBCWYHXMT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-methyl-4,4-bis(2-methylsulfonylethyl)-2-propylchromen-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4,4-bis(2-methylsulfonylethyl)-2-propylchromen-3-one?
The IUPAC name of 2-methyl-4,4-bis(2-methylsulfonylethyl)-2-propylchromen-3-one (CID 70575121) is 2-methyl-4,4-bis(2-methylsulfonylethyl)-2-propylchromen-3-one.
What is the SMILES notation for 2-methyl-4,4-bis(2-methylsulfonylethyl)-2-propylchromen-3-one?
The canonical SMILES for 2-methyl-4,4-bis(2-methylsulfonylethyl)-2-propylchromen-3-one is CCCC1(C)Oc2ccccc2C(CCS(C)(=O)=O)(CCS(C)(=O)=O)C1=O.
What is the InChIKey of 2-methyl-4,4-bis(2-methylsulfonylethyl)-2-propylchromen-3-one?
The InChIKey is NIZSXSBCWYHXMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28O6S2/c1-5-10-18(2)17(20)19(11-13-26(3,21)22,12-14-27(4,23)24)15-8-6-7-9-16(15)25-18/h6-9H,5,10-14H2,1-4H3.
What are the key properties of 2-methyl-4,4-bis(2-methylsulfonylethyl)-2-propylchromen-3-one?
2-methyl-4,4-bis(2-methylsulfonylethyl)-2-propylchromen-3-one has a molecular weight of 416.56 g/mol, XLogP of 2.31, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4,4-bis(2-methylsulfonylethyl)-2-propylchromen-3-one is sourced from PubChem (CID 70575121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).