About 2-[(1R)-3,3-bis(5-methylfuran-2-yl)cyclohexyl]-5-methylfuran
2-[(1R)-3,3-bis(5-methylfuran-2-yl)cyclohexyl]-5-methylfuran (PubChem CID 7057516) has the molecular formula C21H24O3
and a molecular weight of 324.42 g/mol. Its IUPAC name is 2-[(1R)-3,3-bis(5-methylfuran-2-yl)cyclohexyl]-5-methylfuran.
Molecular Properties
| Compound Name | 2-[(1R)-3,3-bis(5-methylfuran-2-yl)cyclohexyl]-5-methylfuran |
| PubChem CID | 7057516 |
| Molecular Formula | C21H24O3 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 2-[(1R)-3,3-bis(5-methylfuran-2-yl)cyclohexyl]-5-methylfuran |
| SMILES | Cc1ccc([C@@H]2CCCC(c3ccc(C)o3)(c3ccc(C)o3)C2)o1 |
| InChI | InChI=1S/C21H24O3/c1-14-6-9-18(22-14)17-5-4-12-21(13-17,19-10-7-15(2)23-19)20-11-8-16(3)24-20/h6-11,17H,4-5,12-13H2,1-3H3/t17-/m1/s1 |
| InChIKey | SGXCGJUVYVGLFV-QGZVFWFLSA-N |
| XLogP | 6.03 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(1R)-3,3-bis(5-methylfuran-2-yl)cyclohexyl]-5-methylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R)-3,3-bis(5-methylfuran-2-yl)cyclohexyl]-5-methylfuran?
The IUPAC name of 2-[(1R)-3,3-bis(5-methylfuran-2-yl)cyclohexyl]-5-methylfuran (CID 7057516) is 2-[(1R)-3,3-bis(5-methylfuran-2-yl)cyclohexyl]-5-methylfuran.
What is the SMILES notation for 2-[(1R)-3,3-bis(5-methylfuran-2-yl)cyclohexyl]-5-methylfuran?
The canonical SMILES for 2-[(1R)-3,3-bis(5-methylfuran-2-yl)cyclohexyl]-5-methylfuran is Cc1ccc([C@@H]2CCCC(c3ccc(C)o3)(c3ccc(C)o3)C2)o1.
What is the InChIKey of 2-[(1R)-3,3-bis(5-methylfuran-2-yl)cyclohexyl]-5-methylfuran?
The InChIKey is SGXCGJUVYVGLFV-QGZVFWFLSA-N. The full InChI is InChI=1S/C21H24O3/c1-14-6-9-18(22-14)17-5-4-12-21(13-17,19-10-7-15(2)23-19)20-11-8-16(3)24-20/h6-11,17H,4-5,12-13H2,1-3H3/t17-/m1/s1.
What are the key properties of 2-[(1R)-3,3-bis(5-methylfuran-2-yl)cyclohexyl]-5-methylfuran?
2-[(1R)-3,3-bis(5-methylfuran-2-yl)cyclohexyl]-5-methylfuran has a molecular weight of 324.42 g/mol, XLogP of 6.03, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R)-3,3-bis(5-methylfuran-2-yl)cyclohexyl]-5-methylfuran is sourced from PubChem (CID 7057516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).