C15H26O2 — CID 7057529
3-[(2R,3aS,6aR)-6,6,6a-trimethyl-3,3a,4,5-tetrahydro-2H-cyclopenta[b]furan-2-yl]-3-methylbutan-2-one (PubChem CID 7057529) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is 3-[(2R,3aS,6aR)-6,6,6a-trimethyl-3,3a,4,5-tetrahydro-2H-cyclopenta[b]furan-2-yl]-3-methylbutan-2-one.
| Compound Name | 3-[(2R,3aS,6aR)-6,6,6a-trimethyl-3,3a,4,5-tetrahydro-2H-cyclopenta[b]furan-2-yl]-3-methylbutan-2-one |
|---|---|
| PubChem CID | 7057529 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 3-[(2R,3aS,6aR)-6,6,6a-trimethyl-3,3a,4,5-tetrahydro-2H-cyclopenta[b]furan-2-yl]-3-methylbutan-2-one |
| SMILES | CC(=O)C(C)(C)[C@H]1C[C@@H]2CCC(C)(C)[C@]2(C)O1 |
| InChI | InChI=1S/C15H26O2/c1-10(16)14(4,5)12-9-11-7-8-13(2,3)15(11,6)17-12/h11-12H,7-9H2,1-6H3/t11-,12+,15+/m0/s1 |
| InChIKey | BPSJENXSYYFKOF-YWPYICTPSA-N |
| XLogP | 3.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |