C22H22F3NO6S — CID 70575380
but-2-enedioic acid;3-methyl-6-[4-(trifluoromethyl)phenyl]sulfanyl-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol (PubChem CID 70575380) has the molecular formula C22H22F3NO6S and a molecular weight of 485.48 g/mol. Its IUPAC name is but-2-enedioic acid;3-methyl-6-[4-(trifluoromethyl)phenyl]sulfanyl-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol.
| Compound Name | but-2-enedioic acid;3-methyl-6-[4-(trifluoromethyl)phenyl]sulfanyl-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol |
|---|---|
| PubChem CID | 70575380 |
| Molecular Formula | C22H22F3NO6S |
| Molecular Weight | 485.48 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | but-2-enedioic acid;3-methyl-6-[4-(trifluoromethyl)phenyl]sulfanyl-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol |
| SMILES | CN1CCc2cc(O)c(O)c(Sc3ccc(C(F)(F)F)cc3)c2CC1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C18H18F3NO2S.C4H4O4/c1-22-8-6-11-10-15(23)16(24)17(14(11)7-9-22)25-13-4-2-12(3-5-13)18(19,20)21;5-3(6)1-2-4(7)8/h2-5,10,23-24H,6-9H2,1H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | HYBVXXUOKNLJGU-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|