C16H20ClN3OS — CID 70575641
2-chloro-N-[(5-ethyl-1,3,4-thiadiazol-2-yl)methyl]-N-(2-methylphenyl)butanamide (PubChem CID 70575641) has the molecular formula C16H20ClN3OS and a molecular weight of 337.88 g/mol. Its IUPAC name is 2-chloro-N-[(5-ethyl-1,3,4-thiadiazol-2-yl)methyl]-N-(2-methylphenyl)butanamide.
| Compound Name | 2-chloro-N-[(5-ethyl-1,3,4-thiadiazol-2-yl)methyl]-N-(2-methylphenyl)butanamide |
|---|---|
| PubChem CID | 70575641 |
| Molecular Formula | C16H20ClN3OS |
| Molecular Weight | 337.88 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 2-chloro-N-[(5-ethyl-1,3,4-thiadiazol-2-yl)methyl]-N-(2-methylphenyl)butanamide |
| SMILES | CCc1nnc(CN(C(=O)C(Cl)CC)c2ccccc2C)s1 |
| InChI | InChI=1S/C16H20ClN3OS/c1-4-12(17)16(21)20(13-9-7-6-8-11(13)3)10-15-19-18-14(5-2)22-15/h6-9,12H,4-5,10H2,1-3H3 |
| InChIKey | GWASKEVYSRQHLS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.88 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|