C17H15N3OS — CID 7057581
(3S,4'S)-2-oxo-3'-sulfanylidenespiro[1H-indole-3,1'-2,4,5,6,7,8-hexahydroisoquinoline]-4'-carbonitrile (PubChem CID 7057581) has the molecular formula C17H15N3OS and a molecular weight of 309.39 g/mol. Its IUPAC name is (3S,4'S)-2-oxo-3'-sulfanylidenespiro[1H-indole-3,1'-2,4,5,6,7,8-hexahydroisoquinoline]-4'-carbonitrile.
| Compound Name | (3S,4'S)-2-oxo-3'-sulfanylidenespiro[1H-indole-3,1'-2,4,5,6,7,8-hexahydroisoquinoline]-4'-carbonitrile |
|---|---|
| PubChem CID | 7057581 |
| Molecular Formula | C17H15N3OS |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | (3S,4'S)-2-oxo-3'-sulfanylidenespiro[1H-indole-3,1'-2,4,5,6,7,8-hexahydroisoquinoline]-4'-carbonitrile |
| SMILES | N#C[C@H]1C(=S)N[C@@]2(C(=O)Nc3ccccc32)C2=C1CCCC2 |
| InChI | InChI=1S/C17H15N3OS/c18-9-11-10-5-1-2-6-12(10)17(20-15(11)22)13-7-3-4-8-14(13)19-16(17)21/h3-4,7-8,11H,1-2,5-6H2,(H,19,21)(H,20,22)/t11-,17+/m1/s1 |
| InChIKey | VUVKZDBJXNEBRR-DIFFPNOSSA-N |
| XLogP | 2.77 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|