C10H18F3N5S — CID 70575970
1-(4-aminobutan-2-yl)-2-(2,2,2-trifluoroethyl)guanidine;1,3-thiazole (PubChem CID 70575970) has the molecular formula C10H18F3N5S and a molecular weight of 297.35 g/mol. Its IUPAC name is 1-(4-aminobutan-2-yl)-2-(2,2,2-trifluoroethyl)guanidine;1,3-thiazole.
| Compound Name | 1-(4-aminobutan-2-yl)-2-(2,2,2-trifluoroethyl)guanidine;1,3-thiazole |
|---|---|
| PubChem CID | 70575970 |
| Molecular Formula | C10H18F3N5S |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 1-(4-aminobutan-2-yl)-2-(2,2,2-trifluoroethyl)guanidine;1,3-thiazole |
| SMILES | CC(CCN)N/C(N)=N/CC(F)(F)F.c1cscn1 |
| InChI | InChI=1S/C7H15F3N4.C3H3NS/c1-5(2-3-11)14-6(12)13-4-7(8,9)10;1-2-5-3-4-1/h5H,2-4,11H2,1H3,(H3,12,13,14);1-3H |
| InChIKey | QPYZMTRYZYKHPM-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|